C14H12ClF3N4O6 — CID 70374884
2-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenoxy]ethylcarbamic acid (PubChem CID 70374884) has the molecular formula C14H12ClF3N4O6 and a molecular weight of 424.72 g/mol. Its IUPAC name is 2-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenoxy]ethylcarbamic acid.
| Compound Name | 2-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 70374884 |
| Molecular Formula | C14H12ClF3N4O6 |
| Molecular Weight | 424.72 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 2-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenoxy]ethylcarbamic acid |
| SMILES | Cn1nc(Oc2ccc([N+](=O)[O-])c(OCCNC(=O)O)c2)c(Cl)c1C(F)(F)F |
| InChI | InChI=1S/C14H12ClF3N4O6/c1-21-11(14(16,17)18)10(15)12(20-21)28-7-2-3-8(22(25)26)9(6-7)27-5-4-19-13(23)24/h2-3,6,19H,4-5H2,1H3,(H,23,24) |
| InChIKey | NXLCPIRONQFGRJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 128.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.72 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|