C16H21N — CID 70375053
1,2,3,4a,5,6,7,8,8a,8b-decahydropyrrolo[1,2-f]phenanthridine (PubChem CID 70375053) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 1,2,3,4a,5,6,7,8,8a,8b-decahydropyrrolo[1,2-f]phenanthridine.
| Compound Name | 1,2,3,4a,5,6,7,8,8a,8b-decahydropyrrolo[1,2-f]phenanthridine |
|---|---|
| PubChem CID | 70375053 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 1,2,3,4a,5,6,7,8,8a,8b-decahydropyrrolo[1,2-f]phenanthridine |
| SMILES | C1=CC2=C3CCCN3C3CCCCC3C2C=C1 |
| InChI | InChI=1S/C16H21N/c1-2-7-14-12(6-1)13-8-3-4-9-15(13)17-11-5-10-16(14)17/h1-2,6-7,12-13,15H,3-5,8-11H2 |
| InChIKey | XTYAXXKSALOXHG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |