C17H17N3O2 — CID 70380603
1,2-diphenyl-3-(2H-triazol-4-yl)propane-1,2-diol (PubChem CID 70380603) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 1,2-diphenyl-3-(2H-triazol-4-yl)propane-1,2-diol.
| Compound Name | 1,2-diphenyl-3-(2H-triazol-4-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 70380603 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 1,2-diphenyl-3-(2H-triazol-4-yl)propane-1,2-diol |
| SMILES | OC(c1ccccc1)C(O)(Cc1cn[nH]n1)c1ccccc1 |
| InChI | InChI=1S/C17H17N3O2/c21-16(13-7-3-1-4-8-13)17(22,11-15-12-18-20-19-15)14-9-5-2-6-10-14/h1-10,12,16,21-22H,11H2,(H,18,19,20) |
| InChIKey | BYRBMINDAXHHIB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |