C10H15N4O8PS — CID 70385978
3,7-dihydropurine-6-thione;[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] dihydrogen phosphate (PubChem CID 70385978) has the molecular formula C10H15N4O8PS and a molecular weight of 382.29 g/mol. Its IUPAC name is 3,7-dihydropurine-6-thione;[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] dihydrogen phosphate.
| Compound Name | 3,7-dihydropurine-6-thione;[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 70385978 |
| Molecular Formula | C10H15N4O8PS |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 3,7-dihydropurine-6-thione;[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC1O[C@H](CO)[C@@H](O)[C@H]1O.S=c1nc[nH]c2nc[nH]c12 |
| InChI | InChI=1S/C5H4N4S.C5H11O8P/c10-5-3-4(7-1-6-3)8-2-9-5;6-1-2-3(7)4(8)5(12-2)13-14(9,10)11/h1-2H,(H2,6,7,8,9,10);2-8H,1H2,(H2,9,10,11)/t;2-,3-,4-,5?/m.1/s1 |
| InChIKey | WGWBSQIYGCBFHD-NWHVNECISA-N |
| XLogP | -1.45 |
| TPSA | 194.04 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|