C20H33NO — CID 70386626
1-(2,3-dihydro-1H-inden-2-yl)-2-(nonan-3-ylamino)ethanol (PubChem CID 70386626) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-2-yl)-2-(nonan-3-ylamino)ethanol.
| Compound Name | 1-(2,3-dihydro-1H-inden-2-yl)-2-(nonan-3-ylamino)ethanol |
|---|---|
| PubChem CID | 70386626 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-2-yl)-2-(nonan-3-ylamino)ethanol |
| SMILES | CCCCCCC(CC)NCC(O)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C20H33NO/c1-3-5-6-7-12-19(4-2)21-15-20(22)18-13-16-10-8-9-11-17(16)14-18/h8-11,18-22H,3-7,12-15H2,1-2H3 |
| InChIKey | YETKZJJECYFZOR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|