C10H20N2O4S — CID 7038712
2-[[(3S,4R)-4-(butylamino)-1,1-dioxothiolan-3-yl]amino]acetic acid (PubChem CID 7038712) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-[[(3S,4R)-4-(butylamino)-1,1-dioxothiolan-3-yl]amino]acetic acid.
| Compound Name | 2-[[(3S,4R)-4-(butylamino)-1,1-dioxothiolan-3-yl]amino]acetic acid |
|---|---|
| PubChem CID | 7038712 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-[[(3S,4R)-4-(butylamino)-1,1-dioxothiolan-3-yl]amino]acetic acid |
| SMILES | CCCCN[C@H]1CS(=O)(=O)C[C@H]1NCC(=O)O |
| InChI | InChI=1S/C10H20N2O4S/c1-2-3-4-11-8-6-17(15,16)7-9(8)12-5-10(13)14/h8-9,11-12H,2-7H2,1H3,(H,13,14)/t8-,9+/m0/s1 |
| InChIKey | WGJQZZMFAUUWBD-DTWKUNHWSA-N |
| XLogP | -0.78 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|