C20H30N2O — CID 70401560
1-(5-amino-2H-pyridin-1-yl)-3,7,11-trimethyldodeca-2,6,10-trien-1-one (PubChem CID 70401560) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is 1-(5-amino-2H-pyridin-1-yl)-3,7,11-trimethyldodeca-2,6,10-trien-1-one.
| Compound Name | 1-(5-amino-2H-pyridin-1-yl)-3,7,11-trimethyldodeca-2,6,10-trien-1-one |
|---|---|
| PubChem CID | 70401560 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 1-(5-amino-2H-pyridin-1-yl)-3,7,11-trimethyldodeca-2,6,10-trien-1-one |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CC(=O)N1C=C(N)C=CC1 |
| InChI | InChI=1S/C20H30N2O/c1-16(2)8-5-9-17(3)10-6-11-18(4)14-20(23)22-13-7-12-19(21)15-22/h7-8,10,12,14-15H,5-6,9,11,13,21H2,1-4H3 |
| InChIKey | YPFUPESVJYXRAJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|