C16H17NO4 — CID 70401985
ethyl 4-oxo-2-[[(1R,2S)-2-phenylcyclopropyl]amino]furan-3-carboxylate (PubChem CID 70401985) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is ethyl 4-oxo-2-[[(1R,2S)-2-phenylcyclopropyl]amino]furan-3-carboxylate.
| Compound Name | ethyl 4-oxo-2-[[(1R,2S)-2-phenylcyclopropyl]amino]furan-3-carboxylate |
|---|---|
| PubChem CID | 70401985 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | ethyl 4-oxo-2-[[(1R,2S)-2-phenylcyclopropyl]amino]furan-3-carboxylate |
| SMILES | CCOC(=O)C1=C(N[C@@H]2C[C@H]2c2ccccc2)OCC1=O |
| InChI | InChI=1S/C16H17NO4/c1-2-20-16(19)14-13(18)9-21-15(14)17-12-8-11(12)10-6-4-3-5-7-10/h3-7,11-12,17H,2,8-9H2,1H3/t11-,12+/m0/s1 |
| InChIKey | IPBVXNACNULKOS-NWDGAFQWSA-N |
| XLogP | 1.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|