C18H24N2O5 — CID 86708339
ethyl 2-[2-[2-(dimethylamino)ethoxy]-4-methylanilino]-4-oxofuran-3-carboxylate (PubChem CID 86708339) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is ethyl 2-[2-[2-(dimethylamino)ethoxy]-4-methylanilino]-4-oxofuran-3-carboxylate.
| Compound Name | ethyl 2-[2-[2-(dimethylamino)ethoxy]-4-methylanilino]-4-oxofuran-3-carboxylate |
|---|---|
| PubChem CID | 86708339 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | ethyl 2-[2-[2-(dimethylamino)ethoxy]-4-methylanilino]-4-oxofuran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(Nc2ccc(C)cc2OCCN(C)C)OCC1=O |
| InChI | InChI=1S/C18H24N2O5/c1-5-23-18(22)16-14(21)11-25-17(16)19-13-7-6-12(2)10-15(13)24-9-8-20(3)4/h6-7,10,19H,5,8-9,11H2,1-4H3 |
| InChIKey | UAANZDIUJMINPM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|