C12H12ClN2O3S- — CID 7040287
(2R)-2-[(4-chlorobenzoyl)carbamothioylamino]butanoate (PubChem CID 7040287) has the molecular formula C12H12ClN2O3S- and a molecular weight of 299.76 g/mol. Its IUPAC name is (2R)-2-[(4-chlorobenzoyl)carbamothioylamino]butanoate.
| Compound Name | (2R)-2-[(4-chlorobenzoyl)carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 7040287 |
| Molecular Formula | C12H12ClN2O3S- |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | (2R)-2-[(4-chlorobenzoyl)carbamothioylamino]butanoate |
| SMILES | CC[C@@H](NC(=S)NC(=O)c1ccc(Cl)cc1)C(=O)[O-] |
| InChI | InChI=1S/C12H13ClN2O3S/c1-2-9(11(17)18)14-12(19)15-10(16)7-3-5-8(13)6-4-7/h3-6,9H,2H2,1H3,(H,17,18)(H2,14,15,16,19)/p-1/t9-/m1/s1 |
| InChIKey | GDOCOLXCALCIIG-SECBINFHSA-M |
| XLogP | 0.47 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|