About imidazo[4,5-g][1]benzazepine
imidazo[4,5-g][1]benzazepine (PubChem CID 70405147) has the molecular formula C11H7N3
and a molecular weight of 181.20 g/mol. Its IUPAC name is imidazo[4,5-g][1]benzazepine.
Molecular Properties
| Compound Name | imidazo[4,5-g][1]benzazepine |
| PubChem CID | 70405147 |
| Molecular Formula | C11H7N3 |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | imidazo[4,5-g][1]benzazepine |
| SMILES | c1ccc2c(ccc3ncnc32)nc1 |
| InChI | InChI=1S/C11H7N3/c1-2-6-12-9-4-5-10-11(8(9)3-1)14-7-13-10/h1-7H |
| InChIKey | DZOXTOVSMREXGT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze imidazo[4,5-g][1]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[4,5-g][1]benzazepine?
The IUPAC name of imidazo[4,5-g][1]benzazepine (CID 70405147) is imidazo[4,5-g][1]benzazepine.
What is the SMILES notation for imidazo[4,5-g][1]benzazepine?
The canonical SMILES for imidazo[4,5-g][1]benzazepine is c1ccc2c(ccc3ncnc32)nc1.
What is the InChIKey of imidazo[4,5-g][1]benzazepine?
The InChIKey is DZOXTOVSMREXGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3/c1-2-6-12-9-4-5-10-11(8(9)3-1)14-7-13-10/h1-7H.
What are the key properties of imidazo[4,5-g][1]benzazepine?
imidazo[4,5-g][1]benzazepine has a molecular weight of 181.20 g/mol, XLogP of 2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[4,5-g][1]benzazepine is sourced from PubChem (CID 70405147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).