C16H26N2O3S — CID 70410988
N-[2-[2-(azepan-1-yl)-1-hydroxyethyl]phenyl]-N-methylmethanesulfonamide (PubChem CID 70410988) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is N-[2-[2-(azepan-1-yl)-1-hydroxyethyl]phenyl]-N-methylmethanesulfonamide.
| Compound Name | N-[2-[2-(azepan-1-yl)-1-hydroxyethyl]phenyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 70410988 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N-[2-[2-(azepan-1-yl)-1-hydroxyethyl]phenyl]-N-methylmethanesulfonamide |
| SMILES | CN(c1ccccc1C(O)CN1CCCCCC1)S(C)(=O)=O |
| InChI | InChI=1S/C16H26N2O3S/c1-17(22(2,20)21)15-10-6-5-9-14(15)16(19)13-18-11-7-3-4-8-12-18/h5-6,9-10,16,19H,3-4,7-8,11-13H2,1-2H3 |
| InChIKey | CTAUULCHSBPGJL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |