C23H26N2O3S — CID 70412478
[3-[2-(4-phenylpiperidin-1-yl)ethylsulfanylmethyl]-1H-indol-6-yl] hydrogen carbonate (PubChem CID 70412478) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is [3-[2-(4-phenylpiperidin-1-yl)ethylsulfanylmethyl]-1H-indol-6-yl] hydrogen carbonate.
| Compound Name | [3-[2-(4-phenylpiperidin-1-yl)ethylsulfanylmethyl]-1H-indol-6-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70412478 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | [3-[2-(4-phenylpiperidin-1-yl)ethylsulfanylmethyl]-1H-indol-6-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc2c(CSCCN3CCC(c4ccccc4)CC3)c[nH]c2c1 |
| InChI | InChI=1S/C23H26N2O3S/c26-23(27)28-20-6-7-21-19(15-24-22(21)14-20)16-29-13-12-25-10-8-18(9-11-25)17-4-2-1-3-5-17/h1-7,14-15,18,24H,8-13,16H2,(H,26,27) |
| InChIKey | HNGLDQSBCYMTJF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|