C28H30N2O3S2 — CID 88607099
[3-[2-(4-phenylpiperidin-1-yl)ethylsulfanylmethyl]-1H-indol-4-yl] benzenesulfonate (PubChem CID 88607099) has the molecular formula C28H30N2O3S2 and a molecular weight of 506.69 g/mol. Its IUPAC name is [3-[2-(4-phenylpiperidin-1-yl)ethylsulfanylmethyl]-1H-indol-4-yl] benzenesulfonate.
| Compound Name | [3-[2-(4-phenylpiperidin-1-yl)ethylsulfanylmethyl]-1H-indol-4-yl] benzenesulfonate |
|---|---|
| PubChem CID | 88607099 |
| Molecular Formula | C28H30N2O3S2 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | [3-[2-(4-phenylpiperidin-1-yl)ethylsulfanylmethyl]-1H-indol-4-yl] benzenesulfonate |
| SMILES | O=S(=O)(Oc1cccc2[nH]cc(CSCCN3CCC(c4ccccc4)CC3)c12)c1ccccc1 |
| InChI | InChI=1S/C28H30N2O3S2/c31-35(32,25-10-5-2-6-11-25)33-27-13-7-12-26-28(27)24(20-29-26)21-34-19-18-30-16-14-23(15-17-30)22-8-3-1-4-9-22/h1-13,20,23,29H,14-19,21H2 |
| InChIKey | MMCLBUKUFWBOKX-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|