C23H25ClN2O4S — CID 70412557
[7-chloro-3-[2-[3-(3-hydroxyphenyl)piperidin-1-yl]ethylsulfanylmethyl]-1H-indol-4-yl] hydrogen carbonate (PubChem CID 70412557) has the molecular formula C23H25ClN2O4S and a molecular weight of 460.98 g/mol. Its IUPAC name is [7-chloro-3-[2-[3-(3-hydroxyphenyl)piperidin-1-yl]ethylsulfanylmethyl]-1H-indol-4-yl] hydrogen carbonate.
| Compound Name | [7-chloro-3-[2-[3-(3-hydroxyphenyl)piperidin-1-yl]ethylsulfanylmethyl]-1H-indol-4-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70412557 |
| Molecular Formula | C23H25ClN2O4S |
| Molecular Weight | 460.98 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | [7-chloro-3-[2-[3-(3-hydroxyphenyl)piperidin-1-yl]ethylsulfanylmethyl]-1H-indol-4-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc(Cl)c2[nH]cc(CSCCN3CCCC(c4cccc(O)c4)C3)c12 |
| InChI | InChI=1S/C23H25ClN2O4S/c24-19-6-7-20(30-23(28)29)21-17(12-25-22(19)21)14-31-10-9-26-8-2-4-16(13-26)15-3-1-5-18(27)11-15/h1,3,5-7,11-12,16,25,27H,2,4,8-10,13-14H2,(H,28,29) |
| InChIKey | YNIFRTWMEOGCKC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.98 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|