C34H35N3O6S — CID 70416003
2,6-dimethyl-4-(3-nitrophenyl)-5-[4-[(E)-3-[2-(pyridin-3-ylmethyl)phenyl]prop-2-enyl]sulfanylbutoxycarbonyl]-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 70416003) has the molecular formula C34H35N3O6S and a molecular weight of 613.74 g/mol. Its IUPAC name is 2,6-dimethyl-4-(3-nitrophenyl)-5-[4-[(E)-3-[2-(pyridin-3-ylmethyl)phenyl]prop-2-enyl]sulfanylbutoxycarbonyl]-1,4-dihydropyridine-3-carboxylic acid.
| Compound Name | 2,6-dimethyl-4-(3-nitrophenyl)-5-[4-[(E)-3-[2-(pyridin-3-ylmethyl)phenyl]prop-2-enyl]sulfanylbutoxycarbonyl]-1,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 70416003 |
| Molecular Formula | C34H35N3O6S |
| Molecular Weight | 613.74 g/mol |
| Exact Mass | 613.22 |
| IUPAC Name | 2,6-dimethyl-4-(3-nitrophenyl)-5-[4-[(E)-3-[2-(pyridin-3-ylmethyl)phenyl]prop-2-enyl]sulfanylbutoxycarbonyl]-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OCCCCSC/C=C/c2ccccc2Cc2cccnc2)=C(C)N1 |
| InChI | InChI=1S/C34H35N3O6S/c1-23-30(33(38)39)32(28-13-7-15-29(21-28)37(41)42)31(24(2)36-23)34(40)43-17-5-6-18-44-19-9-14-26-11-3-4-12-27(26)20-25-10-8-16-35-22-25/h3-4,7-16,21-22,32,36H,5-6,17-20H2,1-2H3,(H,38,39)/b14-9+ |
| InChIKey | MOGAKEUDYMQPJQ-NTEUORMPSA-N |
| XLogP | 6.67 |
| TPSA | 131.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.74 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|