About 2-butyl-6-methylphenol;2-methylaniline
2-butyl-6-methylphenol;2-methylaniline (PubChem CID 70417016) has the molecular formula C18H25NO
and a molecular weight of 271.40 g/mol. Its IUPAC name is 2-butyl-6-methylphenol;2-methylaniline.
Molecular Properties
| Compound Name | 2-butyl-6-methylphenol;2-methylaniline |
| PubChem CID | 70417016 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 2-butyl-6-methylphenol;2-methylaniline |
| SMILES | CCCCc1cccc(C)c1O.Cc1ccccc1N |
| InChI | InChI=1S/C11H16O.C7H9N/c1-3-4-7-10-8-5-6-9(2)11(10)12;1-6-4-2-3-5-7(6)8/h5-6,8,12H,3-4,7H2,1-2H3;2-5H,8H2,1H3 |
| InChIKey | QLYRVVUKTJLJJB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-6-methylphenol;2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-6-methylphenol;2-methylaniline?
The IUPAC name of 2-butyl-6-methylphenol;2-methylaniline (CID 70417016) is 2-butyl-6-methylphenol;2-methylaniline.
What is the SMILES notation for 2-butyl-6-methylphenol;2-methylaniline?
The canonical SMILES for 2-butyl-6-methylphenol;2-methylaniline is CCCCc1cccc(C)c1O.Cc1ccccc1N.
What is the InChIKey of 2-butyl-6-methylphenol;2-methylaniline?
The InChIKey is QLYRVVUKTJLJJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O.C7H9N/c1-3-4-7-10-8-5-6-9(2)11(10)12;1-6-4-2-3-5-7(6)8/h5-6,8,12H,3-4,7H2,1-2H3;2-5H,8H2,1H3.
What are the key properties of 2-butyl-6-methylphenol;2-methylaniline?
2-butyl-6-methylphenol;2-methylaniline has a molecular weight of 271.40 g/mol, XLogP of 4.62, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-6-methylphenol;2-methylaniline is sourced from PubChem (CID 70417016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).