C37H39F3O5S — CID 70418547
methyl 7-[(1S)-1-hydroxy-4-(4-nonylphenyl)-1-[3-(trifluoromethyl)phenyl]but-2-en-2-yl]sulfanyl-4-oxochromene-2-carboxylate (PubChem CID 70418547) has the molecular formula C37H39F3O5S and a molecular weight of 652.78 g/mol. Its IUPAC name is methyl 7-[(1S)-1-hydroxy-4-(4-nonylphenyl)-1-[3-(trifluoromethyl)phenyl]but-2-en-2-yl]sulfanyl-4-oxochromene-2-carboxylate.
| Compound Name | methyl 7-[(1S)-1-hydroxy-4-(4-nonylphenyl)-1-[3-(trifluoromethyl)phenyl]but-2-en-2-yl]sulfanyl-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 70418547 |
| Molecular Formula | C37H39F3O5S |
| Molecular Weight | 652.78 g/mol |
| Exact Mass | 652.25 |
| IUPAC Name | methyl 7-[(1S)-1-hydroxy-4-(4-nonylphenyl)-1-[3-(trifluoromethyl)phenyl]but-2-en-2-yl]sulfanyl-4-oxochromene-2-carboxylate |
| SMILES | CCCCCCCCCc1ccc(CC=C(Sc2ccc3c(=O)cc(C(=O)OC)oc3c2)[C@@H](O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C37H39F3O5S/c1-3-4-5-6-7-8-9-11-25-14-16-26(17-15-25)18-21-34(35(42)27-12-10-13-28(22-27)37(38,39)40)46-29-19-20-30-31(41)24-33(36(43)44-2)45-32(30)23-29/h10,12-17,19-24,35,42H,3-9,11,18H2,1-2H3/t35-/m0/s1 |
| InChIKey | CPBHXVSKMBBLTC-DHUJRADRSA-N |
| XLogP | 9.84 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.78 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|