C30H38O5S — CID 70418544
7-[(2S)-2-hydroxy-1-(4-nonylphenyl)pentan-2-yl]sulfanyl-4-oxochromene-2-carboxylic acid (PubChem CID 70418544) has the molecular formula C30H38O5S and a molecular weight of 510.70 g/mol. Its IUPAC name is 7-[(2S)-2-hydroxy-1-(4-nonylphenyl)pentan-2-yl]sulfanyl-4-oxochromene-2-carboxylic acid.
| Compound Name | 7-[(2S)-2-hydroxy-1-(4-nonylphenyl)pentan-2-yl]sulfanyl-4-oxochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 70418544 |
| Molecular Formula | C30H38O5S |
| Molecular Weight | 510.70 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 7-[(2S)-2-hydroxy-1-(4-nonylphenyl)pentan-2-yl]sulfanyl-4-oxochromene-2-carboxylic acid |
| SMILES | CCCCCCCCCc1ccc(C[C@](O)(CCC)Sc2ccc3c(=O)cc(C(=O)O)oc3c2)cc1 |
| InChI | InChI=1S/C30H38O5S/c1-3-5-6-7-8-9-10-11-22-12-14-23(15-13-22)21-30(34,18-4-2)36-24-16-17-25-26(31)20-28(29(32)33)35-27(25)19-24/h12-17,19-20,34H,3-11,18,21H2,1-2H3,(H,32,33)/t30-/m0/s1 |
| InChIKey | LURQHXLLSFWYFY-PMERELPUSA-N |
| XLogP | 7.61 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.70 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|