C36H37F3O5S — CID 54203528
7-[(1S,2R)-1-hydroxy-4-(3-nonylphenyl)-1-[3-(trifluoromethyl)phenyl]but-3-en-2-yl]sulfanyl-4-oxochromene-2-carboxylic acid (PubChem CID 54203528) has the molecular formula C36H37F3O5S and a molecular weight of 638.75 g/mol. Its IUPAC name is 7-[(1S,2R)-1-hydroxy-4-(3-nonylphenyl)-1-[3-(trifluoromethyl)phenyl]but-3-en-2-yl]sulfanyl-4-oxochromene-2-carboxylic acid.
| Compound Name | 7-[(1S,2R)-1-hydroxy-4-(3-nonylphenyl)-1-[3-(trifluoromethyl)phenyl]but-3-en-2-yl]sulfanyl-4-oxochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 54203528 |
| Molecular Formula | C36H37F3O5S |
| Molecular Weight | 638.75 g/mol |
| Exact Mass | 638.23 |
| IUPAC Name | 7-[(1S,2R)-1-hydroxy-4-(3-nonylphenyl)-1-[3-(trifluoromethyl)phenyl]but-3-en-2-yl]sulfanyl-4-oxochromene-2-carboxylic acid |
| SMILES | CCCCCCCCCc1cccc(C=C[C@@H](Sc2ccc3c(=O)cc(C(=O)O)oc3c2)[C@@H](O)c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C36H37F3O5S/c1-2-3-4-5-6-7-8-11-24-12-9-13-25(20-24)16-19-33(34(41)26-14-10-15-27(21-26)36(37,38)39)45-28-17-18-29-30(40)23-32(35(42)43)44-31(29)22-28/h9-10,12-23,33-34,41H,2-8,11H2,1H3,(H,42,43)/t33-,34+/m1/s1 |
| InChIKey | PQWZWGMRDKWYLB-NOCHOARKSA-N |
| XLogP | 9.71 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.75 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|