C31H40O5S — CID 70418362
7-[(2R)-2-hydroxy-1-(3-nonylphenyl)hexan-2-yl]sulfanyl-4-oxochromene-2-carboxylic acid (PubChem CID 70418362) has the molecular formula C31H40O5S and a molecular weight of 524.72 g/mol. Its IUPAC name is 7-[(2R)-2-hydroxy-1-(3-nonylphenyl)hexan-2-yl]sulfanyl-4-oxochromene-2-carboxylic acid.
| Compound Name | 7-[(2R)-2-hydroxy-1-(3-nonylphenyl)hexan-2-yl]sulfanyl-4-oxochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 70418362 |
| Molecular Formula | C31H40O5S |
| Molecular Weight | 524.72 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 7-[(2R)-2-hydroxy-1-(3-nonylphenyl)hexan-2-yl]sulfanyl-4-oxochromene-2-carboxylic acid |
| SMILES | CCCCCCCCCc1cccc(C[C@@](O)(CCCC)Sc2ccc3c(=O)cc(C(=O)O)oc3c2)c1 |
| InChI | InChI=1S/C31H40O5S/c1-3-5-7-8-9-10-11-13-23-14-12-15-24(19-23)22-31(35,18-6-4-2)37-25-16-17-26-27(32)21-29(30(33)34)36-28(26)20-25/h12,14-17,19-21,35H,3-11,13,18,22H2,1-2H3,(H,33,34)/t31-/m1/s1 |
| InChIKey | UTQJXEYGTSAFJI-WJOKGBTCSA-N |
| XLogP | 8.00 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.72 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|