C30H37ClO5S — CID 70420370
methyl 7-[(2S)-4-chloro-2-hydroxy-1-(2-nonylphenyl)butan-2-yl]sulfanyl-4-oxochromene-2-carboxylate (PubChem CID 70420370) has the molecular formula C30H37ClO5S and a molecular weight of 545.14 g/mol. Its IUPAC name is methyl 7-[(2S)-4-chloro-2-hydroxy-1-(2-nonylphenyl)butan-2-yl]sulfanyl-4-oxochromene-2-carboxylate.
| Compound Name | methyl 7-[(2S)-4-chloro-2-hydroxy-1-(2-nonylphenyl)butan-2-yl]sulfanyl-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 70420370 |
| Molecular Formula | C30H37ClO5S |
| Molecular Weight | 545.14 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | methyl 7-[(2S)-4-chloro-2-hydroxy-1-(2-nonylphenyl)butan-2-yl]sulfanyl-4-oxochromene-2-carboxylate |
| SMILES | CCCCCCCCCc1ccccc1C[C@@](O)(CCCl)Sc1ccc2c(=O)cc(C(=O)OC)oc2c1 |
| InChI | InChI=1S/C30H37ClO5S/c1-3-4-5-6-7-8-9-12-22-13-10-11-14-23(22)21-30(34,17-18-31)37-24-15-16-25-26(32)20-28(29(33)35-2)36-27(25)19-24/h10-11,13-16,19-20,34H,3-9,12,17-18,21H2,1-2H3/t30-/m1/s1 |
| InChIKey | HWLIRRLFEJAKPW-SSEXGKCCSA-N |
| XLogP | 7.53 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.14 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|