C36H36O11S — CID 57256248
7-[(1R,2S)-10-(4-acetyl-3-hydroxy-2-propylphenoxy)-1-(5-carboxyfuran-2-yl)-1-hydroxydeca-3,5-dien-2-yl]sulfanyl-4-oxochromene-2-carboxylic acid (PubChem CID 57256248) has the molecular formula C36H36O11S and a molecular weight of 676.74 g/mol. Its IUPAC name is 7-[(1R,2S)-10-(4-acetyl-3-hydroxy-2-propylphenoxy)-1-(5-carboxyfuran-2-yl)-1-hydroxydeca-3,5-dien-2-yl]sulfanyl-4-oxochromene-2-carboxylic acid.
| Compound Name | 7-[(1R,2S)-10-(4-acetyl-3-hydroxy-2-propylphenoxy)-1-(5-carboxyfuran-2-yl)-1-hydroxydeca-3,5-dien-2-yl]sulfanyl-4-oxochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 57256248 |
| Molecular Formula | C36H36O11S |
| Molecular Weight | 676.74 g/mol |
| Exact Mass | 676.20 |
| IUPAC Name | 7-[(1R,2S)-10-(4-acetyl-3-hydroxy-2-propylphenoxy)-1-(5-carboxyfuran-2-yl)-1-hydroxydeca-3,5-dien-2-yl]sulfanyl-4-oxochromene-2-carboxylic acid |
| SMILES | CCCc1c(OCCCCC=CC=C[C@H](Sc2ccc3c(=O)cc(C(=O)O)oc3c2)[C@H](O)c2ccc(C(=O)O)o2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C36H36O11S/c1-3-10-25-27(15-14-23(21(2)37)33(25)39)45-18-9-7-5-4-6-8-11-32(34(40)28-16-17-29(46-28)35(41)42)48-22-12-13-24-26(38)20-31(36(43)44)47-30(24)19-22/h4,6,8,11-17,19-20,32,34,39-40H,3,5,7,9-10,18H2,1-2H3,(H,41,42)(H,43,44)/t32-,34+/m0/s1 |
| InChIKey | MFMBJCQXEVHCKU-UZNNEEJFSA-N |
| XLogP | 7.20 |
| TPSA | 184.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.74 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|