C35H34O12S — CID 88525082
methyl 4-[(1R,2S,3E,5Z)-8-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-(2-carboxyoxy-4-oxochromen-7-yl)sulfanyl-1-hydroxyocta-3,5-dienyl]furan-2-carboxylate (PubChem CID 88525082) has the molecular formula C35H34O12S and a molecular weight of 678.71 g/mol. Its IUPAC name is methyl 4-[(1R,2S,3E,5Z)-8-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-(2-carboxyoxy-4-oxochromen-7-yl)sulfanyl-1-hydroxyocta-3,5-dienyl]furan-2-carboxylate.
| Compound Name | methyl 4-[(1R,2S,3E,5Z)-8-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-(2-carboxyoxy-4-oxochromen-7-yl)sulfanyl-1-hydroxyocta-3,5-dienyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 88525082 |
| Molecular Formula | C35H34O12S |
| Molecular Weight | 678.71 g/mol |
| Exact Mass | 678.18 |
| IUPAC Name | methyl 4-[(1R,2S,3E,5Z)-8-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-(2-carboxyoxy-4-oxochromen-7-yl)sulfanyl-1-hydroxyocta-3,5-dienyl]furan-2-carboxylate |
| SMILES | CCCc1c(OCC/C=C\C=C\[C@H](Sc2ccc3c(=O)cc(OC(=O)O)oc3c2)[C@H](O)c2coc(C(=O)OC)c2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C35H34O12S/c1-4-9-25-27(14-13-23(20(2)36)33(25)39)44-15-8-6-5-7-10-30(32(38)21-16-29(45-19-21)34(40)43-3)48-22-11-12-24-26(37)18-31(47-35(41)42)46-28(24)17-22/h5-7,10-14,16-19,30,32,38-39H,4,8-9,15H2,1-3H3,(H,41,42)/b6-5-,10-7+/t30-,32+/m0/s1 |
| InChIKey | TTXFCEFGXLUABH-BBJUSCHNSA-N |
| XLogP | 6.87 |
| TPSA | 182.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.71 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|