C34H35F5O9S — CID 88525607
[7-[(4R,5S,6E,8Z)-13-(4-acetyl-3-hydroxy-2-propylphenoxy)-1,1,1,2,2-pentafluoro-4-hydroxytrideca-6,8-dien-5-yl]sulfanyl-4-oxochromen-2-yl] hydrogen carbonate (PubChem CID 88525607) has the molecular formula C34H35F5O9S and a molecular weight of 714.70 g/mol. Its IUPAC name is [7-[(4R,5S,6E,8Z)-13-(4-acetyl-3-hydroxy-2-propylphenoxy)-1,1,1,2,2-pentafluoro-4-hydroxytrideca-6,8-dien-5-yl]sulfanyl-4-oxochromen-2-yl] hydrogen carbonate.
| Compound Name | [7-[(4R,5S,6E,8Z)-13-(4-acetyl-3-hydroxy-2-propylphenoxy)-1,1,1,2,2-pentafluoro-4-hydroxytrideca-6,8-dien-5-yl]sulfanyl-4-oxochromen-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 88525607 |
| Molecular Formula | C34H35F5O9S |
| Molecular Weight | 714.70 g/mol |
| Exact Mass | 714.19 |
| IUPAC Name | [7-[(4R,5S,6E,8Z)-13-(4-acetyl-3-hydroxy-2-propylphenoxy)-1,1,1,2,2-pentafluoro-4-hydroxytrideca-6,8-dien-5-yl]sulfanyl-4-oxochromen-2-yl] hydrogen carbonate |
| SMILES | CCCc1c(OCCCC/C=C\C=C\[C@H](Sc2ccc3c(=O)cc(OC(=O)O)oc3c2)[C@H](O)CC(F)(F)C(F)(F)F)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C34H35F5O9S/c1-3-10-24-27(15-14-22(20(2)40)31(24)43)46-16-9-7-5-4-6-8-11-29(26(42)19-33(35,36)34(37,38)39)49-21-12-13-23-25(41)18-30(48-32(44)45)47-28(23)17-21/h4,6,8,11-15,17-18,26,29,42-43H,3,5,7,9-10,16,19H2,1-2H3,(H,44,45)/b6-4-,11-8+/t26-,29+/m1/s1 |
| InChIKey | NFHMBQAFQBBHSP-REPLYDHYSA-N |
| XLogP | 8.48 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.70 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|