C31H29Cl2F3O9S — CID 88525601
[7-[(3R,4S,5E,7Z)-10-(4-acetyl-3-hydroxy-2-propylphenoxy)-2,2-dichloro-1,1,1-trifluoro-3-hydroxydeca-5,7-dien-4-yl]sulfanyl-4-oxochromen-2-yl] hydrogen carbonate (PubChem CID 88525601) has the molecular formula C31H29Cl2F3O9S and a molecular weight of 705.53 g/mol. Its IUPAC name is [7-[(3R,4S,5E,7Z)-10-(4-acetyl-3-hydroxy-2-propylphenoxy)-2,2-dichloro-1,1,1-trifluoro-3-hydroxydeca-5,7-dien-4-yl]sulfanyl-4-oxochromen-2-yl] hydrogen carbonate.
| Compound Name | [7-[(3R,4S,5E,7Z)-10-(4-acetyl-3-hydroxy-2-propylphenoxy)-2,2-dichloro-1,1,1-trifluoro-3-hydroxydeca-5,7-dien-4-yl]sulfanyl-4-oxochromen-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 88525601 |
| Molecular Formula | C31H29Cl2F3O9S |
| Molecular Weight | 705.53 g/mol |
| Exact Mass | 704.09 |
| IUPAC Name | [7-[(3R,4S,5E,7Z)-10-(4-acetyl-3-hydroxy-2-propylphenoxy)-2,2-dichloro-1,1,1-trifluoro-3-hydroxydeca-5,7-dien-4-yl]sulfanyl-4-oxochromen-2-yl] hydrogen carbonate |
| SMILES | CCCc1c(OCC/C=C\C=C\[C@H](Sc2ccc3c(=O)cc(OC(=O)O)oc3c2)[C@@H](O)C(Cl)(Cl)C(F)(F)F)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C31H29Cl2F3O9S/c1-3-8-21-23(13-12-19(17(2)37)27(21)39)43-14-7-5-4-6-9-25(28(40)30(32,33)31(34,35)36)46-18-10-11-20-22(38)16-26(45-29(41)42)44-24(20)15-18/h4-6,9-13,15-16,25,28,39-40H,3,7-8,14H2,1-2H3,(H,41,42)/b5-4-,9-6+/t25-,28+/m0/s1 |
| InChIKey | LUKYTNUOLZCFJI-UFVYSEJJSA-N |
| XLogP | 7.85 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.53 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|