C38H37F3O9S — CID 88623175
[3-[(1R,2S)-9-(4-acetyl-3-hydroxy-2-propylphenoxy)-1-hydroxy-1-[3-(trifluoromethyl)phenyl]nona-3,5-dien-2-yl]-4-oxo-7-sulfanylidene-6H-chromen-2-yl] methyl carbonate (PubChem CID 88623175) has the molecular formula C38H37F3O9S and a molecular weight of 726.77 g/mol. Its IUPAC name is [3-[(1R,2S)-9-(4-acetyl-3-hydroxy-2-propylphenoxy)-1-hydroxy-1-[3-(trifluoromethyl)phenyl]nona-3,5-dien-2-yl]-4-oxo-7-sulfanylidene-6H-chromen-2-yl] methyl carbonate.
| Compound Name | [3-[(1R,2S)-9-(4-acetyl-3-hydroxy-2-propylphenoxy)-1-hydroxy-1-[3-(trifluoromethyl)phenyl]nona-3,5-dien-2-yl]-4-oxo-7-sulfanylidene-6H-chromen-2-yl] methyl carbonate |
|---|---|
| PubChem CID | 88623175 |
| Molecular Formula | C38H37F3O9S |
| Molecular Weight | 726.77 g/mol |
| Exact Mass | 726.21 |
| IUPAC Name | [3-[(1R,2S)-9-(4-acetyl-3-hydroxy-2-propylphenoxy)-1-hydroxy-1-[3-(trifluoromethyl)phenyl]nona-3,5-dien-2-yl]-4-oxo-7-sulfanylidene-6H-chromen-2-yl] methyl carbonate |
| SMILES | CCCc1c(OCCCC=CC=C[C@@H](c2c(OC(=O)OC)oc3c(c2=O)=CCC(=S)C=3)[C@@H](O)c2cccc(C(F)(F)F)c2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C38H37F3O9S/c1-4-11-27-30(18-17-26(22(2)42)34(27)44)48-19-9-7-5-6-8-14-29(33(43)23-12-10-13-24(20-23)38(39,40)41)32-35(45)28-16-15-25(51)21-31(28)49-36(32)50-37(46)47-3/h5-6,8,10,12-14,16-18,20-21,29,33,43-44H,4,7,9,11,15,19H2,1-3H3/t29-,33-/m0/s1 |
| InChIKey | XIASAMQKCZTPPE-ZQAZVOLISA-N |
| XLogP | 6.79 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.77 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|