C35H37F5O8S — CID 57263632
7-[(5R,6S)-14-(4-acetyl-3-hydroxy-2-propylphenoxy)-1,1,1,2,2-pentafluoro-5-hydroxytetradeca-7,9-dien-6-yl]sulfanyl-4-oxochromene-2-carboxylic acid (PubChem CID 57263632) has the molecular formula C35H37F5O8S and a molecular weight of 712.73 g/mol. Its IUPAC name is 7-[(5R,6S)-14-(4-acetyl-3-hydroxy-2-propylphenoxy)-1,1,1,2,2-pentafluoro-5-hydroxytetradeca-7,9-dien-6-yl]sulfanyl-4-oxochromene-2-carboxylic acid.
| Compound Name | 7-[(5R,6S)-14-(4-acetyl-3-hydroxy-2-propylphenoxy)-1,1,1,2,2-pentafluoro-5-hydroxytetradeca-7,9-dien-6-yl]sulfanyl-4-oxochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 57263632 |
| Molecular Formula | C35H37F5O8S |
| Molecular Weight | 712.73 g/mol |
| Exact Mass | 712.21 |
| IUPAC Name | 7-[(5R,6S)-14-(4-acetyl-3-hydroxy-2-propylphenoxy)-1,1,1,2,2-pentafluoro-5-hydroxytetradeca-7,9-dien-6-yl]sulfanyl-4-oxochromene-2-carboxylic acid |
| SMILES | CCCc1c(OCCCCC=CC=C[C@H](Sc2ccc3c(=O)cc(C(=O)O)oc3c2)[C@H](O)CCC(F)(F)C(F)(F)F)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C35H37F5O8S/c1-3-10-25-28(15-14-23(21(2)41)32(25)44)47-18-9-7-5-4-6-8-11-31(26(42)16-17-34(36,37)35(38,39)40)49-22-12-13-24-27(43)20-30(33(45)46)48-29(24)19-22/h4,6,8,11-15,19-20,26,31,42,44H,3,5,7,9-10,16-18H2,1-2H3,(H,45,46)/t26-,31+/m1/s1 |
| InChIKey | IUNCIVKGYLRRRR-NEEKEDPPSA-N |
| XLogP | 8.51 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.73 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|