C32H31F5O9S — CID 88525610
[7-[(4R,5S,6E,8Z)-11-(4-acetyl-3-hydroxy-2-propylphenoxy)-1,1,1,2,2-pentafluoro-4-hydroxyundeca-6,8-dien-5-yl]sulfanyl-4-oxochromen-2-yl] hydrogen carbonate (PubChem CID 88525610) has the molecular formula C32H31F5O9S and a molecular weight of 686.65 g/mol. Its IUPAC name is [7-[(4R,5S,6E,8Z)-11-(4-acetyl-3-hydroxy-2-propylphenoxy)-1,1,1,2,2-pentafluoro-4-hydroxyundeca-6,8-dien-5-yl]sulfanyl-4-oxochromen-2-yl] hydrogen carbonate.
| Compound Name | [7-[(4R,5S,6E,8Z)-11-(4-acetyl-3-hydroxy-2-propylphenoxy)-1,1,1,2,2-pentafluoro-4-hydroxyundeca-6,8-dien-5-yl]sulfanyl-4-oxochromen-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 88525610 |
| Molecular Formula | C32H31F5O9S |
| Molecular Weight | 686.65 g/mol |
| Exact Mass | 686.16 |
| IUPAC Name | [7-[(4R,5S,6E,8Z)-11-(4-acetyl-3-hydroxy-2-propylphenoxy)-1,1,1,2,2-pentafluoro-4-hydroxyundeca-6,8-dien-5-yl]sulfanyl-4-oxochromen-2-yl] hydrogen carbonate |
| SMILES | CCCc1c(OCC/C=C\C=C\[C@H](Sc2ccc3c(=O)cc(OC(=O)O)oc3c2)[C@H](O)CC(F)(F)C(F)(F)F)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C32H31F5O9S/c1-3-8-22-25(13-12-20(18(2)38)29(22)41)44-14-7-5-4-6-9-27(24(40)17-31(33,34)32(35,36)37)47-19-10-11-21-23(39)16-28(46-30(42)43)45-26(21)15-19/h4-6,9-13,15-16,24,27,40-41H,3,7-8,14,17H2,1-2H3,(H,42,43)/b5-4-,9-6+/t24-,27+/m1/s1 |
| InChIKey | OFSBRKRNEMXGER-OZIRGCDMSA-N |
| XLogP | 7.70 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.65 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|