C23H21N2O7P — CID 70419392
2-[2-(4-phenylmethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylic acid;phosphoric acid (PubChem CID 70419392) has the molecular formula C23H21N2O7P and a molecular weight of 468.40 g/mol. Its IUPAC name is 2-[2-(4-phenylmethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylic acid;phosphoric acid.
| Compound Name | 2-[2-(4-phenylmethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylic acid;phosphoric acid |
|---|---|
| PubChem CID | 70419392 |
| Molecular Formula | C23H21N2O7P |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 2-[2-(4-phenylmethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylic acid;phosphoric acid |
| SMILES | O=C(O)c1cccc2[nH]c(C=Cc3ccc(OCc4ccccc4)cc3)nc12.O=P(O)(O)O |
| InChI | InChI=1S/C23H18N2O3.H3O4P/c26-23(27)19-7-4-8-20-22(19)25-21(24-20)14-11-16-9-12-18(13-10-16)28-15-17-5-2-1-3-6-17;1-5(2,3)4/h1-14H,15H2,(H,24,25)(H,26,27);(H3,1,2,3,4) |
| InChIKey | GCHFKUSCCKLRFP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 152.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|