C23H19N2O6P — CID 70419390
phosphono 2-[(E)-2-(4-phenylmethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate (PubChem CID 70419390) has the molecular formula C23H19N2O6P and a molecular weight of 450.39 g/mol. Its IUPAC name is phosphono 2-[(E)-2-(4-phenylmethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate.
| Compound Name | phosphono 2-[(E)-2-(4-phenylmethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 70419390 |
| Molecular Formula | C23H19N2O6P |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | phosphono 2-[(E)-2-(4-phenylmethoxyphenyl)ethenyl]-1H-benzimidazole-4-carboxylate |
| SMILES | O=C(OP(=O)(O)O)c1cccc2[nH]c(/C=C/c3ccc(OCc4ccccc4)cc3)nc12 |
| InChI | InChI=1S/C23H19N2O6P/c26-23(31-32(27,28)29)19-7-4-8-20-22(19)25-21(24-20)14-11-16-9-12-18(13-10-16)30-15-17-5-2-1-3-6-17/h1-14H,15H2,(H,24,25)(H2,27,28,29)/b14-11+ |
| InChIKey | BCIUCAJIMUMANL-SDNWHVSQSA-N |
| XLogP | 4.56 |
| TPSA | 121.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|