About chloro 3-phenylhex-2-enoate
chloro 3-phenylhex-2-enoate (PubChem CID 70423435) has the molecular formula C12H13ClO2
and a molecular weight of 224.69 g/mol. Its IUPAC name is chloro 3-phenylhex-2-enoate.
Molecular Properties
| Compound Name | chloro 3-phenylhex-2-enoate |
| PubChem CID | 70423435 |
| Molecular Formula | C12H13ClO2 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | chloro 3-phenylhex-2-enoate |
| SMILES | CCCC(=CC(=O)OCl)c1ccccc1 |
| InChI | InChI=1S/C12H13ClO2/c1-2-6-11(9-12(14)15-13)10-7-4-3-5-8-10/h3-5,7-9H,2,6H2,1H3 |
| InChIKey | AVSYPNUGJGBBIQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze chloro 3-phenylhex-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro 3-phenylhex-2-enoate?
The IUPAC name of chloro 3-phenylhex-2-enoate (CID 70423435) is chloro 3-phenylhex-2-enoate.
What is the SMILES notation for chloro 3-phenylhex-2-enoate?
The canonical SMILES for chloro 3-phenylhex-2-enoate is CCCC(=CC(=O)OCl)c1ccccc1.
What is the InChIKey of chloro 3-phenylhex-2-enoate?
The InChIKey is AVSYPNUGJGBBIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClO2/c1-2-6-11(9-12(14)15-13)10-7-4-3-5-8-10/h3-5,7-9H,2,6H2,1H3.
What are the key properties of chloro 3-phenylhex-2-enoate?
chloro 3-phenylhex-2-enoate has a molecular weight of 224.69 g/mol, XLogP of 3.57, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloro 3-phenylhex-2-enoate is sourced from PubChem (CID 70423435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).