C27H37NO4 — CID 70425736
N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[6-[(E)-hex-1-enyl]-1,3-benzodioxol-5-yl]-N-methylpropan-1-amine (PubChem CID 70425736) has the molecular formula C27H37NO4 and a molecular weight of 439.60 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[6-[(E)-hex-1-enyl]-1,3-benzodioxol-5-yl]-N-methylpropan-1-amine.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[6-[(E)-hex-1-enyl]-1,3-benzodioxol-5-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 70425736 |
| Molecular Formula | C27H37NO4 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[6-[(E)-hex-1-enyl]-1,3-benzodioxol-5-yl]-N-methylpropan-1-amine |
| SMILES | CCCC/C=C/c1cc2c(cc1CCCN(C)CCc1ccc(OC)c(OC)c1)OCO2 |
| InChI | InChI=1S/C27H37NO4/c1-5-6-7-8-10-22-18-26-27(32-20-31-26)19-23(22)11-9-15-28(2)16-14-21-12-13-24(29-3)25(17-21)30-4/h8,10,12-13,17-19H,5-7,9,11,14-16,20H2,1-4H3/b10-8+ |
| InChIKey | MKSFLWFJKLSWCA-CSKARUKUSA-N |
| XLogP | 5.74 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|