C23H36N4O3S — CID 70431320
N-(4-ethylsulfonyl-1-piperazin-1-ylhexyl)-6-methoxy-4-methylquinolin-8-amine (PubChem CID 70431320) has the molecular formula C23H36N4O3S and a molecular weight of 448.63 g/mol. Its IUPAC name is N-(4-ethylsulfonyl-1-piperazin-1-ylhexyl)-6-methoxy-4-methylquinolin-8-amine.
| Compound Name | N-(4-ethylsulfonyl-1-piperazin-1-ylhexyl)-6-methoxy-4-methylquinolin-8-amine |
|---|---|
| PubChem CID | 70431320 |
| Molecular Formula | C23H36N4O3S |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | N-(4-ethylsulfonyl-1-piperazin-1-ylhexyl)-6-methoxy-4-methylquinolin-8-amine |
| SMILES | CCC(CCC(Nc1cc(OC)cc2c(C)ccnc12)N1CCNCC1)S(=O)(=O)CC |
| InChI | InChI=1S/C23H36N4O3S/c1-5-19(31(28,29)6-2)7-8-22(27-13-11-24-12-14-27)26-21-16-18(30-4)15-20-17(3)9-10-25-23(20)21/h9-10,15-16,19,22,24,26H,5-8,11-14H2,1-4H3 |
| InChIKey | HWSQKAYZPGOSHW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |