C19H24N2O7 — CID 70439974
[2,6-dimethyl-5-(2-methylpropoxycarbonyloxy)-4-(1-oxidopyridin-1-ium-3-yl)-1,4-dihydropyridin-3-yl] methyl carbonate (PubChem CID 70439974) has the molecular formula C19H24N2O7 and a molecular weight of 392.41 g/mol. Its IUPAC name is [2,6-dimethyl-5-(2-methylpropoxycarbonyloxy)-4-(1-oxidopyridin-1-ium-3-yl)-1,4-dihydropyridin-3-yl] methyl carbonate.
| Compound Name | [2,6-dimethyl-5-(2-methylpropoxycarbonyloxy)-4-(1-oxidopyridin-1-ium-3-yl)-1,4-dihydropyridin-3-yl] methyl carbonate |
|---|---|
| PubChem CID | 70439974 |
| Molecular Formula | C19H24N2O7 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | [2,6-dimethyl-5-(2-methylpropoxycarbonyloxy)-4-(1-oxidopyridin-1-ium-3-yl)-1,4-dihydropyridin-3-yl] methyl carbonate |
| SMILES | COC(=O)OC1=C(C)NC(C)=C(OC(=O)OCC(C)C)C1c1ccc[n+]([O-])c1 |
| InChI | InChI=1S/C19H24N2O7/c1-11(2)10-26-19(23)28-17-13(4)20-12(3)16(27-18(22)25-5)15(17)14-7-6-8-21(24)9-14/h6-9,11,15,20H,10H2,1-5H3 |
| InChIKey | SPTLLNDXXMRDFC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 110.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|