C10H14F3N3O3 — CID 7044498
N-[(4R)-1-(2-methylpropyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]acetamide (PubChem CID 7044498) has the molecular formula C10H14F3N3O3 and a molecular weight of 281.23 g/mol. Its IUPAC name is N-[(4R)-1-(2-methylpropyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]acetamide.
| Compound Name | N-[(4R)-1-(2-methylpropyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 7044498 |
| Molecular Formula | C10H14F3N3O3 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-[(4R)-1-(2-methylpropyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]acetamide |
| SMILES | CC(=O)N[C@@]1(C(F)(F)F)NC(=O)N(CC(C)C)C1=O |
| InChI | InChI=1S/C10H14F3N3O3/c1-5(2)4-16-7(18)9(10(11,12)13,14-6(3)17)15-8(16)19/h5H,4H2,1-3H3,(H,14,17)(H,15,19)/t9-/m1/s1 |
| InChIKey | DSNMOTGTZWRBEU-SECBINFHSA-N |
| XLogP | 0.59 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|