C22H38O5 — CID 70445691
2-[2-[(2R,3aR,4S,5S,6aR)-5-hydroxy-4-(1-hydroxy-5-methylnon-1-enyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethoxy]acetic acid (PubChem CID 70445691) has the molecular formula C22H38O5 and a molecular weight of 382.54 g/mol. Its IUPAC name is 2-[2-[(2R,3aR,4S,5S,6aR)-5-hydroxy-4-(1-hydroxy-5-methylnon-1-enyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethoxy]acetic acid.
| Compound Name | 2-[2-[(2R,3aR,4S,5S,6aR)-5-hydroxy-4-(1-hydroxy-5-methylnon-1-enyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 70445691 |
| Molecular Formula | C22H38O5 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 2-[2-[(2R,3aR,4S,5S,6aR)-5-hydroxy-4-(1-hydroxy-5-methylnon-1-enyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethoxy]acetic acid |
| SMILES | CCCCC(C)CCC=C(O)[C@H]1[C@@H]2C[C@H](CCOCC(=O)O)C[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C22H38O5/c1-3-4-6-15(2)7-5-8-19(23)22-18-12-16(9-10-27-14-21(25)26)11-17(18)13-20(22)24/h8,15-18,20,22-24H,3-7,9-14H2,1-2H3,(H,25,26)/t15?,16-,17-,18-,20+,22-/m1/s1 |
| InChIKey | IBSZQYPYTGMSQS-VCPWLZCPSA-N |
| XLogP | 4.55 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|