C27H30N4O5 — CID 70450361
but-2-enedioic acid;N-[2-[N-[3-(dimethylamino)propyl]anilino]-3-pyridinyl]benzamide (PubChem CID 70450361) has the molecular formula C27H30N4O5 and a molecular weight of 490.56 g/mol. Its IUPAC name is but-2-enedioic acid;N-[2-[N-[3-(dimethylamino)propyl]anilino]-3-pyridinyl]benzamide.
| Compound Name | but-2-enedioic acid;N-[2-[N-[3-(dimethylamino)propyl]anilino]-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 70450361 |
| Molecular Formula | C27H30N4O5 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | but-2-enedioic acid;N-[2-[N-[3-(dimethylamino)propyl]anilino]-3-pyridinyl]benzamide |
| SMILES | CN(C)CCCN(c1ccccc1)c1ncccc1NC(=O)c1ccccc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C23H26N4O.C4H4O4/c1-26(2)17-10-18-27(20-13-7-4-8-14-20)22-21(15-9-16-24-22)25-23(28)19-11-5-3-6-12-19;5-3(6)1-2-4(7)8/h3-9,11-16H,10,17-18H2,1-2H3,(H,25,28);1-2H,(H,5,6)(H,7,8) |
| InChIKey | RSTXFNVFRVVMOD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 123.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|