C19H24N4O3 — CID 70452242
3-(4-hydroxy-3-methoxyphenyl)-1-[4-(2-imidazol-1-ylethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 70452242) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is 3-(4-hydroxy-3-methoxyphenyl)-1-[4-(2-imidazol-1-ylethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(4-hydroxy-3-methoxyphenyl)-1-[4-(2-imidazol-1-ylethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 70452242 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 3-(4-hydroxy-3-methoxyphenyl)-1-[4-(2-imidazol-1-ylethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)N2CCN(CCn3ccnc3)CC2)ccc1O |
| InChI | InChI=1S/C19H24N4O3/c1-26-18-14-16(2-4-17(18)24)3-5-19(25)23-12-10-21(11-13-23)8-9-22-7-6-20-15-22/h2-7,14-15,24H,8-13H2,1H3 |
| InChIKey | UHJDXEWKMSFTLI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|