C20H24O4 — CID 70453624
(2E,5Z)-7-[(1S,2S,3S,4R)-3-(phenoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-2,5-dienoic acid (PubChem CID 70453624) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (2E,5Z)-7-[(1S,2S,3S,4R)-3-(phenoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-2,5-dienoic acid.
| Compound Name | (2E,5Z)-7-[(1S,2S,3S,4R)-3-(phenoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-2,5-dienoic acid |
|---|---|
| PubChem CID | 70453624 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (2E,5Z)-7-[(1S,2S,3S,4R)-3-(phenoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-2,5-dienoic acid |
| SMILES | O=C(O)/C=C/C/C=C\C[C@H]1[C@@H](COc2ccccc2)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C20H24O4/c21-20(22)11-7-2-1-6-10-16-17(19-13-12-18(16)24-19)14-23-15-8-4-3-5-9-15/h1,3-9,11,16-19H,2,10,12-14H2,(H,21,22)/b6-1-,11-7+/t16-,17+,18-,19+/m0/s1 |
| InChIKey | LNWPIGSYCMIZOE-OVXYDBHBSA-N |
| XLogP | 3.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|