C34H42ClN3O4 — CID 70454445
[1-butyl-2-methyl-3-[[1-(2-phenylethyl)piperidin-4-yl]carbamoyl]indol-5-yl] benzoate;hydrate;hydrochloride (PubChem CID 70454445) has the molecular formula C34H42ClN3O4 and a molecular weight of 592.18 g/mol. Its IUPAC name is [1-butyl-2-methyl-3-[[1-(2-phenylethyl)piperidin-4-yl]carbamoyl]indol-5-yl] benzoate;hydrate;hydrochloride.
| Compound Name | [1-butyl-2-methyl-3-[[1-(2-phenylethyl)piperidin-4-yl]carbamoyl]indol-5-yl] benzoate;hydrate;hydrochloride |
|---|---|
| PubChem CID | 70454445 |
| Molecular Formula | C34H42ClN3O4 |
| Molecular Weight | 592.18 g/mol |
| Exact Mass | 591.29 |
| IUPAC Name | [1-butyl-2-methyl-3-[[1-(2-phenylethyl)piperidin-4-yl]carbamoyl]indol-5-yl] benzoate;hydrate;hydrochloride |
| SMILES | CCCCn1c(C)c(C(=O)NC2CCN(CCc3ccccc3)CC2)c2cc(OC(=O)c3ccccc3)ccc21.Cl.O |
| InChI | InChI=1S/C34H39N3O3.ClH.H2O/c1-3-4-20-37-25(2)32(30-24-29(15-16-31(30)37)40-34(39)27-13-9-6-10-14-27)33(38)35-28-18-22-36(23-19-28)21-17-26-11-7-5-8-12-26;;/h5-16,24,28H,3-4,17-23H2,1-2H3,(H,35,38);1H;1H2 |
| InChIKey | BDWULAGYYXOKES-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.18 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|