C20H35N3O5 — CID 70467423
1-[2-[[2-hydroxy-3-[4-[2-(2-methylpropoxy)ethoxy]phenoxy]propyl]amino]ethyl]-1,3-dimethylurea (PubChem CID 70467423) has the molecular formula C20H35N3O5 and a molecular weight of 397.52 g/mol. Its IUPAC name is 1-[2-[[2-hydroxy-3-[4-[2-(2-methylpropoxy)ethoxy]phenoxy]propyl]amino]ethyl]-1,3-dimethylurea.
| Compound Name | 1-[2-[[2-hydroxy-3-[4-[2-(2-methylpropoxy)ethoxy]phenoxy]propyl]amino]ethyl]-1,3-dimethylurea |
|---|---|
| PubChem CID | 70467423 |
| Molecular Formula | C20H35N3O5 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | 1-[2-[[2-hydroxy-3-[4-[2-(2-methylpropoxy)ethoxy]phenoxy]propyl]amino]ethyl]-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)CCNCC(O)COc1ccc(OCCOCC(C)C)cc1 |
| InChI | InChI=1S/C20H35N3O5/c1-16(2)14-26-11-12-27-18-5-7-19(8-6-18)28-15-17(24)13-22-9-10-23(4)20(25)21-3/h5-8,16-17,22,24H,9-15H2,1-4H3,(H,21,25) |
| InChIKey | OHNXCDGSEDAGFN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|