C20H24N2 — CID 70472060
(4S,5S)-4-methyl-9,12-diazapentacyclo[10.7.2.05,20.08,21.013,18]henicosa-1(19),10,13(18),16,20-pentaene (PubChem CID 70472060) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is (4S,5S)-4-methyl-9,12-diazapentacyclo[10.7.2.05,20.08,21.013,18]henicosa-1(19),10,13(18),16,20-pentaene.
| Compound Name | (4S,5S)-4-methyl-9,12-diazapentacyclo[10.7.2.05,20.08,21.013,18]henicosa-1(19),10,13(18),16,20-pentaene |
|---|---|
| PubChem CID | 70472060 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (4S,5S)-4-methyl-9,12-diazapentacyclo[10.7.2.05,20.08,21.013,18]henicosa-1(19),10,13(18),16,20-pentaene |
| SMILES | C[C@H]1CCC2=CC3=C(CCC=C3)N3C=CNC4CC[C@@H]1C2=C43 |
| InChI | InChI=1S/C20H24N2/c1-13-6-7-15-12-14-4-2-3-5-18(14)22-11-10-21-17-9-8-16(13)19(15)20(17)22/h2,4,10-13,16-17,21H,3,5-9H2,1H3/t13-,16-,17?/m0/s1 |
| InChIKey | UEJPHFOGJJIBHV-CCBDSKLWSA-N |
| XLogP | 4.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |