C17H24N2 — CID 66674003
2,3,4,4a,9a,9b,10,11,12,13-decahydro-1H-pyrido[1,2-f]phenanthridin-8-amine (PubChem CID 66674003) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2,3,4,4a,9a,9b,10,11,12,13-decahydro-1H-pyrido[1,2-f]phenanthridin-8-amine.
| Compound Name | 2,3,4,4a,9a,9b,10,11,12,13-decahydro-1H-pyrido[1,2-f]phenanthridin-8-amine |
|---|---|
| PubChem CID | 66674003 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 2,3,4,4a,9a,9b,10,11,12,13-decahydro-1H-pyrido[1,2-f]phenanthridin-8-amine |
| SMILES | NC1=CC2C3CCCCC3=C3CCCCC3N2C=C1 |
| InChI | InChI=1S/C17H24N2/c18-12-9-10-19-16-8-4-3-6-14(16)13-5-1-2-7-15(13)17(19)11-12/h9-11,15-17H,1-8,18H2 |
| InChIKey | ZVQWGEQMBFWUMQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|