C19H28N2 — CID 67925273
4-[2-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)ethyl]cyclohexan-1-amine (PubChem CID 67925273) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 4-[2-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)ethyl]cyclohexan-1-amine.
| Compound Name | 4-[2-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 67925273 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 4-[2-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)ethyl]cyclohexan-1-amine |
| SMILES | NC1CCC(CCN2C=CC(C3=CCC=CC3)=CC2)CC1 |
| InChI | InChI=1S/C19H28N2/c20-19-8-6-16(7-9-19)10-13-21-14-11-18(12-15-21)17-4-2-1-3-5-17/h1-2,5,11-12,14,16,19H,3-4,6-10,13,15,20H2 |
| InChIKey | LAFJRUVUVSSKHQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|