C21H21N5O3 — CID 70473113
6-methoxy-2-[[1-phenoxy-3-(2H-tetrazol-5-yl)propoxy]methyl]quinoline (PubChem CID 70473113) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is 6-methoxy-2-[[1-phenoxy-3-(2H-tetrazol-5-yl)propoxy]methyl]quinoline.
| Compound Name | 6-methoxy-2-[[1-phenoxy-3-(2H-tetrazol-5-yl)propoxy]methyl]quinoline |
|---|---|
| PubChem CID | 70473113 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 6-methoxy-2-[[1-phenoxy-3-(2H-tetrazol-5-yl)propoxy]methyl]quinoline |
| SMILES | COc1ccc2nc(COC(CCc3nn[nH]n3)Oc3ccccc3)ccc2c1 |
| InChI | InChI=1S/C21H21N5O3/c1-27-18-9-10-19-15(13-18)7-8-16(22-19)14-28-21(12-11-20-23-25-26-24-20)29-17-5-3-2-4-6-17/h2-10,13,21H,11-12,14H2,1H3,(H,23,24,25,26) |
| InChIKey | SMDPPJRDBZPSFV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|