C17H23NO3 — CID 90190351
2-(3,3-diethoxypropyl)-7-methoxyquinoline (PubChem CID 90190351) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-(3,3-diethoxypropyl)-7-methoxyquinoline.
| Compound Name | 2-(3,3-diethoxypropyl)-7-methoxyquinoline |
|---|---|
| PubChem CID | 90190351 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2-(3,3-diethoxypropyl)-7-methoxyquinoline |
| SMILES | CCOC(CCc1ccc2ccc(OC)cc2n1)OCC |
| InChI | InChI=1S/C17H23NO3/c1-4-20-17(21-5-2)11-9-14-8-6-13-7-10-15(19-3)12-16(13)18-14/h6-8,10,12,17H,4-5,9,11H2,1-3H3 |
| InChIKey | NBKWOUDSHUDTOO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|