C43H62O5 — CID 70473633
3-methoxy-1-[4-[4-(3-methoxypropanoyl)-2-(4-pentylcyclohexyl)benzoyl]-3-(4-pentylcyclohexyl)phenyl]propan-1-one (PubChem CID 70473633) has the molecular formula C43H62O5 and a molecular weight of 658.96 g/mol. Its IUPAC name is 3-methoxy-1-[4-[4-(3-methoxypropanoyl)-2-(4-pentylcyclohexyl)benzoyl]-3-(4-pentylcyclohexyl)phenyl]propan-1-one.
| Compound Name | 3-methoxy-1-[4-[4-(3-methoxypropanoyl)-2-(4-pentylcyclohexyl)benzoyl]-3-(4-pentylcyclohexyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 70473633 |
| Molecular Formula | C43H62O5 |
| Molecular Weight | 658.96 g/mol |
| Exact Mass | 658.46 |
| IUPAC Name | 3-methoxy-1-[4-[4-(3-methoxypropanoyl)-2-(4-pentylcyclohexyl)benzoyl]-3-(4-pentylcyclohexyl)phenyl]propan-1-one |
| SMILES | CCCCCC1CCC(c2cc(C(=O)CCOC)ccc2C(=O)c2ccc(C(=O)CCOC)cc2C2CCC(CCCCC)CC2)CC1 |
| InChI | InChI=1S/C43H62O5/c1-5-7-9-11-31-13-17-33(18-14-31)39-29-35(41(44)25-27-47-3)21-23-37(39)43(46)38-24-22-36(42(45)26-28-48-4)30-40(38)34-19-15-32(16-20-34)12-10-8-6-2/h21-24,29-34H,5-20,25-28H2,1-4H3 |
| InChIKey | FQTIMWPTIGRHJO-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.96 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|