About [5-(2-hydroxyethoxycarbonyloxy)-4-(2-methoxyphenyl)-2,6-dimethyl-3-pyridinyl] methyl carbonate
[5-(2-hydroxyethoxycarbonyloxy)-4-(2-methoxyphenyl)-2,6-dimethyl-3-pyridinyl] methyl carbonate (PubChem CID 70473809) has the molecular formula C19H21NO8
and a molecular weight of 391.38 g/mol. Its IUPAC name is [5-(2-hydroxyethoxycarbonyloxy)-4-(2-methoxyphenyl)-2,6-dimethyl-3-pyridinyl] methyl carbonate.
Molecular Properties
| Compound Name | [5-(2-hydroxyethoxycarbonyloxy)-4-(2-methoxyphenyl)-2,6-dimethyl-3-pyridinyl] methyl carbonate |
| PubChem CID | 70473809 |
| Molecular Formula | C19H21NO8 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | [5-(2-hydroxyethoxycarbonyloxy)-4-(2-methoxyphenyl)-2,6-dimethyl-3-pyridinyl] methyl carbonate |
| SMILES | COC(=O)Oc1c(C)nc(C)c(OC(=O)OCCO)c1-c1ccccc1OC |
| InChI | InChI=1S/C19H21NO8/c1-11-16(27-18(22)25-4)15(13-7-5-6-8-14(13)24-3)17(12(2)20-11)28-19(23)26-10-9-21/h5-8,21H,9-10H2,1-4H3 |
| InChIKey | YBBJNKMLJCZHBY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze [5-(2-hydroxyethoxycarbonyloxy)-4-(2-methoxyphenyl)-2,6-dimethyl-3-pyridinyl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-hydroxyethoxycarbonyloxy)-4-(2-methoxyphenyl)-2,6-dimethyl-3-pyridinyl] methyl carbonate?
The IUPAC name of [5-(2-hydroxyethoxycarbonyloxy)-4-(2-methoxyphenyl)-2,6-dimethyl-3-pyridinyl] methyl carbonate (CID 70473809) is [5-(2-hydroxyethoxycarbonyloxy)-4-(2-methoxyphenyl)-2,6-dimethyl-3-pyridinyl] methyl carbonate.
What is the SMILES notation for [5-(2-hydroxyethoxycarbonyloxy)-4-(2-methoxyphenyl)-2,6-dimethyl-3-pyridinyl] methyl carbonate?
The canonical SMILES for [5-(2-hydroxyethoxycarbonyloxy)-4-(2-methoxyphenyl)-2,6-dimethyl-3-pyridinyl] methyl carbonate is COC(=O)Oc1c(C)nc(C)c(OC(=O)OCCO)c1-c1ccccc1OC.
What is the InChIKey of [5-(2-hydroxyethoxycarbonyloxy)-4-(2-methoxyphenyl)-2,6-dimethyl-3-pyridinyl] methyl carbonate?
The InChIKey is YBBJNKMLJCZHBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO8/c1-11-16(27-18(22)25-4)15(13-7-5-6-8-14(13)24-3)17(12(2)20-11)28-19(23)26-10-9-21/h5-8,21H,9-10H2,1-4H3.
What are the key properties of [5-(2-hydroxyethoxycarbonyloxy)-4-(2-methoxyphenyl)-2,6-dimethyl-3-pyridinyl] methyl carbonate?
[5-(2-hydroxyethoxycarbonyloxy)-4-(2-methoxyphenyl)-2,6-dimethyl-3-pyridinyl] methyl carbonate has a molecular weight of 391.38 g/mol, XLogP of 3.03, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-hydroxyethoxycarbonyloxy)-4-(2-methoxyphenyl)-2,6-dimethyl-3-pyridinyl] methyl carbonate is sourced from PubChem (CID 70473809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).