C17H15ClF3N5O3 — CID 70474524
[2,4-diamino-5-(2-chlorophenyl)-7-methyl-5,8-dihydropyrido[2,3-d]pyrimidin-6-yl] 2,2,2-trifluoroethyl carbonate (PubChem CID 70474524) has the molecular formula C17H15ClF3N5O3 and a molecular weight of 429.79 g/mol. Its IUPAC name is [2,4-diamino-5-(2-chlorophenyl)-7-methyl-5,8-dihydropyrido[2,3-d]pyrimidin-6-yl] 2,2,2-trifluoroethyl carbonate.
| Compound Name | [2,4-diamino-5-(2-chlorophenyl)-7-methyl-5,8-dihydropyrido[2,3-d]pyrimidin-6-yl] 2,2,2-trifluoroethyl carbonate |
|---|---|
| PubChem CID | 70474524 |
| Molecular Formula | C17H15ClF3N5O3 |
| Molecular Weight | 429.79 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | [2,4-diamino-5-(2-chlorophenyl)-7-methyl-5,8-dihydropyrido[2,3-d]pyrimidin-6-yl] 2,2,2-trifluoroethyl carbonate |
| SMILES | CC1=C(OC(=O)OCC(F)(F)F)C(c2ccccc2Cl)c2c(N)nc(N)nc2N1 |
| InChI | InChI=1S/C17H15ClF3N5O3/c1-7-12(29-16(27)28-6-17(19,20)21)10(8-4-2-3-5-9(8)18)11-13(22)25-15(23)26-14(11)24-7/h2-5,10H,6H2,1H3,(H5,22,23,24,25,26) |
| InChIKey | DDRWNTCPBFLIGX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.79 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |